|
|
| | 5-NITRO-2-BENZIMIDAZOLINONE Basic information |
| | 5-NITRO-2-BENZIMIDAZOLINONE Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 203.0±19.0 °C(Predicted) | | density | 1.506±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | pka | 10.75±0.30(Predicted) | | Appearance | Light yellow to yellow Solid | | Water Solubility | Insoluble in water. | | BRN | 171386 | | InChI | InChI=1S/C7H5N3O3/c11-7-8-5-2-1-4(10(12)13)3-6(5)9-7/h1-3H,(H2,8,9,11) | | InChIKey | DLJZIPVEVJOKHB-UHFFFAOYSA-N | | SMILES | C1(=O)NC2=CC=C([N+]([O-])=O)C=C2N1 | | LogP | 1.35 at 23℃ and pH6.5-7.5 | | CAS DataBase Reference | 93-84-5(CAS DataBase Reference) | | EPA Substance Registry System | 2H-Benzimidazol-2-one, 1,3-dihydro-5-nitro- (93-84-5) |
| Risk Statements | 20/22 | | Safety Statements | 22-36/37-36 | | RIDADR | 2811 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 5-NITRO-2-BENZIMIDAZOLINONE Usage And Synthesis |
| Chemical Properties | Yellow to brown powder | | Uses | 5-Nitro-2-benzimidazolinone is used as intermediates. |
| | 5-NITRO-2-BENZIMIDAZOLINONE Preparation Products And Raw materials |
|