| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Ethyl(2-iodobenzoyl)acetate Basic information |
| | Ethyl(2-iodobenzoyl)acetate Chemical Properties |
| Boiling point | 142-144 °C/0.4 mmHg (lit.) | | density | 1.609 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5865(lit.) | | Fp | >230 °F | | pka | 9.80±0.46(Predicted) | | InChI | InChI=1S/C11H11IO3/c1-2-7(11(14)15)10(13)8-5-3-4-6-9(8)12/h3-7H,2H2,1H3,(H,14,15) | | InChIKey | QRONKOHIQRRFOP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(CC)C(=O)C1=CC=CC=C1I |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Ethyl(2-iodobenzoyl)acetate Usage And Synthesis |
| | Ethyl(2-iodobenzoyl)acetate Preparation Products And Raw materials |
|