|
|
| | ETHYL (4-IODOBENZOYL)ACETATE Basic information |
| | ETHYL (4-IODOBENZOYL)ACETATE Chemical Properties |
| Boiling point | 349.7±22.0 °C(Predicted) | | density | 1.609 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.6070(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.52±0.25(Predicted) | | Appearance | Light yellow to yellow Liquid | | InChI | 1S/C11H11IO3/c1-2-15-11(14)7-10(13)8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3 | | InChIKey | DOIUIJYPQHAHLM-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)c1ccc(I)cc1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | ETHYL (4-IODOBENZOYL)ACETATE Usage And Synthesis |
| Uses | Reactant for:• ;Synthesis of trisubstituted pyrroles via rearrangement reactions catalyzed by Ir catalyst1• ;Preparation of biologically active molecules2,3,4 | | Uses | Reactant for:
- Synthesis of trisubstituted pyrroles via rearrangement reactions catalyzed by Ir catalyst
- Preparation of biologically active molecules
|
| | ETHYL (4-IODOBENZOYL)ACETATE Preparation Products And Raw materials |
|