| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Cyano-4-fluorobenzenesulfonyl chloride Basic information |
| | 3-Cyano-4-fluorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 67-70 °C (lit.) | | Boiling point | 332.8±27.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | low-melting solid | | color | Pale yellow | | Sensitive | Moisture Sensitive | | InChI | 1S/C7H3ClFNO2S/c8-13(11,12)6-1-2-7(9)5(3-6)4-10/h1-3H | | InChIKey | KDVZADPGGPBAAK-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1C#N)S(Cl)(=O)=O | | CAS DataBase Reference | 351003-23-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29269090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Cyano-4-fluorobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | White to tan powder |
| | 3-Cyano-4-fluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|