| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:cis-Pinonic acid, 98% CAS:61826-55-9 Purity:98% Package:5GR
|
|
| | PINONIC ACID Basic information |
| Product Name: | PINONIC ACID | | Synonyms: | cis-Pinonic acid 98%;2-(3-Acetyl-2,2-dimethylcyclobutyl);Cis-3-Acetyl-2,2-Dimethylcyclobutaneacetic Acid(WXC02163);LABOTEST-BB LT00012631;CIS-3-ACETYL-2,2-DIMETHYL-CYCLOBUTANEACETIC ACID;CIS-PINONIC ACID;AKOS BB-9735;PINONIC ACID | | CAS: | 61826-55-9 | | MF: | C10H16O3 | | MW: | 184.23 | | EINECS: | | | Product Categories: | | | Mol File: | 61826-55-9.mol |  |
| | PINONIC ACID Chemical Properties |
| Melting point | 104-107 °C (lit.) | | Boiling point | 258.19°C (rough estimate) | | density | 1.0655 (rough estimate) | | refractive index | 1.5230 (estimate) | | pka | 4.72±0.10(Predicted) | | form | solid | | InChI | 1S/C10H16O3/c1-6(11)8-4-7(5-9(12)13)10(8,2)3/h7-8H,4-5H2,1-3H3,(H,12,13)/t7-,8+/m1/s1 | | InChIKey | SIZDUQQDBXJXLQ-SFYZADRCSA-N | | SMILES | CC(=O)[C@@H]1C[C@H](CC(O)=O)C1(C)C | | EPA Substance Registry System | Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl-, (1R,3R)-rel- (61826-55-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | PINONIC ACID Usage And Synthesis |
| Chemical Properties | WHITE TO SLIGHTLY YELLOW CRYSTALLINE SOLID | | Uses | cis-Pinonic acid undergoes oxidation to produce secondary organic aerosol (SOA). | | General Description | cis-Pinonic acid undergoes oxidation to produce secondary organic aerosol (SOA). |
| | PINONIC ACID Preparation Products And Raw materials |
|