| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-TROGER'S BASE Basic information |
| Product Name: | (+)-TROGER'S BASE | | Synonyms: | (+)-TROGER'S BASE;(5R,11R)-(+)-2,8-DIMETHYL-6H,12H-5,11-METHANODIBENZO[B,F][1,5]DIAZOCIN;(5R,11R)-(+)-2,8-DIMETHYL-6H,12H-5,11-METHANODIBENZO(B,F)(1,5)DIAZOCINE;(R)-2,8-dimethyl-5,11-methanodibenzo (B,F)(1,5)diazocin;(+)-TROGER'S BASE, FLUKABRAND CHIRA-SELE CT REAGENT, 99+%;(+)-trǒger's base;(+)-Trδgers base;(+)-Trδgers base, (5R,11R)-(+)-2,8-Dimethyl-6H,12H-5,11-methanodibenzo[b,f][1,5]diazocine | | CAS: | 21451-74-1 | | MF: | C17H18N2 | | MW: | 250.34 | | EINECS: | | | Product Categories: | | | Mol File: | 21451-74-1.mol |  |
| | (+)-TROGER'S BASE Chemical Properties |
| Melting point | 127-131 °C(lit.) | | Boiling point | 461.0±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 4.53±0.20(Predicted) | | Optical Rotation | [α]20/D +283±4°, c = 0.3% in hexane | | BRN | 88612 | | InChI | 1S/C17H18N2/c1-12-3-5-16-14(7-12)9-18-11-19(16)10-15-8-13(2)4-6-17(15)18/h3-8H,9-11H2,1-2H3 | | InChIKey | SXPSZIHEWFTLEQ-UHFFFAOYSA-N | | SMILES | Cc1ccc2[N@H]3C[N@@H](Cc2c1)c4ccc(C)cc4C3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-TROGER'S BASE Usage And Synthesis |
| Uses | It was used as an standard analyte for testing the enantioseparation capability of the chiral stationary phase column; in a study to understand the covalently bonded cellulose tris(3,5-dimethylphenylcarbamate) on a silica monolithic capillary column. | | General Description | Trger base (TB) is a chiral heterocyclic amine with chirality due to the presence of two stereogenic nitrogen atoms. |
| | (+)-TROGER'S BASE Preparation Products And Raw materials |
|