|
|
| | Diphenylmethoxyphosphine Basic information |
| | Diphenylmethoxyphosphine Chemical Properties |
| Boiling point | 149 °C6 mm Hg(lit.) | | density | 1.078 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.604(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to very slightly yellow | | Specific Gravity | 1.078 | | Sensitive | Air & Moisture Sensitive | | BRN | 1640480 | | InChI | InChI=1S/C13H13OP/c1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 | | InChIKey | OAADXJFIBNEPLY-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1)(C1=CC=CC=C1)OC | | CAS DataBase Reference | 4020-99-9(CAS DataBase Reference) | | NIST Chemistry Reference | Methyl diphenylphosphinite(4020-99-9) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-36 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Diphenylmethoxyphosphine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | Ased as:
- Catalyst for hydroformylative desymmetrization of bisalkenyl carbinols and bishomoallylic carbinols
- Ligand in rhodium-catalyzed hydroformylation of bishomoallylic alcohols
- Calatyst in preparation of γ-lactones via branched-regioselective hydroformylation reactions
- Ligand for nickel-catalyzed hydrocyanation reactions
- Catalyst in annulation reactions
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling | | Synthesis | The general procedure for the synthesis of diphenylmethoxyphosphine from diphenylphosphonium chloride is as follows: 210 g (6.56 mol) of anhydrous methanol was cooled to -15°C under nitrogen protection. At this temperature, 200 g (0.907 mol) of diphenylphosphonium chloride was vigorously stirred and slowly added dropwise. Subsequently, 18 g (1.06 mol) of ammonia was passed. After cooling was withdrawn, stirring of the reaction mixture was continued for 10 h. Upon completion of the reaction, the product was separated by diafiltration. The filtrate was distilled under reduced pressure to remove methanol and excess ammonia. The residue was filtered by pumping through a glass sand core funnel to give 143 g of crude diphenylmethoxyphosphine in 73% yield of the theoretical value. | | References | [1] Patent: US5705669, 1998, A |
| | Diphenylmethoxyphosphine Preparation Products And Raw materials |
|