| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
CLP257 manufacturers
- CLP257
-
- $38.00
-
2026-07-15
- CAS:1181081-71-9
- Purity: 99.50%
- Supply Ability: 10g
|
| Product Name: | CLP257 | | Synonyms: | (5Z)-5-[(4-Fluoro-2-hydroxyphenyl)methylene]-2-(tetrahydro-1-(2H)-pyridazinyl)-4(5H)-thiazolone;CLP257;4(5H)-Thiazolone, 5-[(4-fluoro-2-hydroxyphenyl)methylene]-2-(tetrahydro-1(2H)-pyridazinyl)-, (5Z)-;Inhibitor,post-translationally,hypersensitivity,plasma,Potassium Channel,neuropathic,antihyperalgesic,CLP 257,membrane,KcsA,mechanical,sensitivity,CLP-257,CLP257,KCC2,inhibit;(Z)-5-(4-fluoro-2-hydroxybenzylidene)-2-(tetrahydropyridazin-1(2H)-yl)thiazol-4(5H)-one;CLP257, 10 mM in DMSO | | CAS: | 1181081-71-9 | | MF: | C14H14FN3O2S | | MW: | 307.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1181081-71-9.mol |  |
| | CLP257 Chemical Properties |
| Boiling point | 473.3±55.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 20 mg/ml | | form | powder | | pka | 7.23±0.40(Predicted) | | color | white to yellow to light brown | | InChI | 1S/C14H14FN3O2S/c15-10-4-3-9(11(19)8-10)7-12-13(20)17-14(21-12)18-6-2-1-5-16-18/h3-4,7-8,16,19H,1-2,5-6H2/b12-7- | | InChIKey | SKCADXVKQRCWTR-GHXNOFRVSA-N | | SMILES | O=C1/C(SC(N2CCCCN2)=N1)=C/C3=CC=C(F)C=C3O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | CLP257 Usage And Synthesis |
| Uses | CLP257 has been used as a K+- Cl- cotransporter 2 (KCC2) enhancer in human neuron culture. | | Biochem/physiol Actions | CLP257 is a selective K+-Cl cotransporter KCC2 activator that restored impaired Cl transport in neurons with reduced KCC2 activity. Apparently, CLP257 modulates plasmalemmal KCC2 protein turnover post-translationally. | | storage | Store at +4°C |
| | CLP257 Preparation Products And Raw materials |
|