| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2'-Deoxy-2-fluoroadenosine Basic information |
| | 2'-Deoxy-2-fluoroadenosine Chemical Properties |
| Melting point | 218 °C (dec.) | | storage temp. | 2-8°C, sealed storage, away from moisture and light | | form | crystals | | color | White to off-white | | Optical Rotation | [α]20/D -16°, c = 1 in methanol | | InChI | 1S/C10H12FN5O3/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,14,15)/t4-,5+,6+/m0/s1 | | InChIKey | ZWPYUXAXLRFWQC-KVQBGUIXSA-N | | SMILES | Nc1nc(F)nc2n(cnc12)[C@H]3C[C@H](O)[C@@H](CO)O3 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2'-Deoxy-2-fluoroadenosine Usage And Synthesis |
| Uses | 2-Fluoro-2’-deoxyadenosine is an analog tested to the susceptibility of clinical metronidazole-resistant Trichomonas vaginalis. Also, it is one of two purine nucleoside that forms a suicide system as a powerful killing and bystander effects on tumor cells. | | Definition | ChEBI: 2'-deoxy-2-fluoroadenosine is a member of adenosines and an organofluorine compound. |
| | 2'-Deoxy-2-fluoroadenosine Preparation Products And Raw materials |
|