|
|
| | 3-(4'-CHLOROPHENYL)PROPYL CHLORIDE Basic information |
| Product Name: | 3-(4'-CHLOROPHENYL)PROPYL CHLORIDE | | Synonyms: | 1-CHLORO-3-(4-CHLOROPHENYL)PROPANE;1-chloro-4-(3-chloropropyl)benzene;3(P-CHLOROPHENYL)PROPYL CHLORIDE;3-(4zzhlxy-chlorophenyl)propyl chloride;3-(4-chlorophenyl)-1-chloropropane;Benzene, 1-chloro-4-(3-chloropropyl)-;3-(4'-chlorophenyl)propyl chloride;3-(4′-Chlorophenyl)propyl chloride, CAS 64473-34-3 | | CAS: | 64473-34-3 | | MF: | C9H10Cl2 | | MW: | 189.08 | | EINECS: | | | Product Categories: | | | Mol File: | 64473-34-3.mol |  |
| | 3-(4'-CHLOROPHENYL)PROPYL CHLORIDE Chemical Properties |
| Melting point | 0°C | | Boiling point | 0°C | | density | 1.166±0.06 g/cm3(Predicted) | | Fp | 0°C | | form | liquid | | color | Clear | | InChI | InChI=1S/C9H10Cl2/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6H,1-2,7H2 | | InChIKey | FYUVHLUSUWWUPY-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(CCCCl)C=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 3-(4'-CHLOROPHENYL)PROPYL CHLORIDE Usage And Synthesis |
| | 3-(4'-CHLOROPHENYL)PROPYL CHLORIDE Preparation Products And Raw materials |
|