| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-[(E)-2-Nitrovinyl]phenylboronic acid Basic information |
| | 3-[(E)-2-Nitrovinyl]phenylboronic acid Chemical Properties |
| Melting point | 232-236°C | | form | solid | | InChI | 1S/C8H8BNO4/c11-9(12)8-3-1-2-7(6-8)4-5-10(13)14/h1-6,11-12H/b5-4+ | | InChIKey | WBBJYMBZMJTILK-SNAWJCMRSA-N | | SMILES | OB(O)c1cccc(\C=C\[N+]([O-])=O)c1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-22 | | Safety Statements | 22-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-[(E)-2-Nitrovinyl]phenylboronic acid Usage And Synthesis |
| | 3-[(E)-2-Nitrovinyl]phenylboronic acid Preparation Products And Raw materials |
|