| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-(Tributylstannyl)furan Basic information |
| | 2-(Tributylstannyl)furan Chemical Properties |
| Boiling point | 90 °C/0.1 mmHg (lit.) | | density | 1.134 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.494(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | Specific Gravity | 1.134 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/C4H3O.3C4H9.Sn/c1-2-4-5-3-1;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3; | | InChIKey | SANWDQJIWZEKOD-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccco1 | | CAS DataBase Reference | 118486-94-5(CAS DataBase Reference) |
| Hazard Codes | T,N,Xi | | Risk Statements | 21-25-36/38-48/23/25-50/53-36/37/38 | | Safety Statements | 35-36/37/39-45-60-61-28-26 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | F | 10 | | TSCA | No | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29321900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 2-(Tributylstannyl)furan Usage And Synthesis |
| Uses | It is an agrochemical, organic and pharmaceutical intermediates. | | Synthesis | Weigh tributyltin chloride, in 30mL furan reflux stirring 10h. Filtering, filtrate concentrated to the appropriate volume under reduced pressure, add 3mL ~ 5mL petroleum ether, low-temperature standing, to be completely precipitated after filtration, the crude product is recrystallized with dichloromethane - petroleum ether. The crude product was recrystallized by dichloromethane-petroleum ether. After removing the solvent and purified by repeated washing with petroleum ether, colorless viscous liquid 2-(tributylstannyl)furan was obtained. |
| | 2-(Tributylstannyl)furan Preparation Products And Raw materials |
|