|
|
| | 6-Chloro-2-methylquinoline-3-carboxylic acid Basic information |
| | 6-Chloro-2-methylquinoline-3-carboxylic acid Chemical Properties |
| storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H8ClNO2/c1-6-9(11(14)15)5-7-4-8(12)2-3-10(7)13-6/h2-5H,1H3,(H,14,15) | | InChIKey | BXNOWQXNZZNEJV-UHFFFAOYSA-N | | SMILES | Clc1cc2c(nc(c(c2)C(=O)O)C)cc1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-Chloro-2-methylquinoline-3-carboxylic acid Usage And Synthesis |
| Uses | 6-Chloro-2-methyl-quinoline-3-carboxylic acid |
| | 6-Chloro-2-methylquinoline-3-carboxylic acid Preparation Products And Raw materials |
|