| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Ethyl pentafluoropropionate Basic information |
| | Ethyl pentafluoropropionate Chemical Properties |
| Melting point | 75.5°C | | Boiling point | 75-76 °C (lit.) | | density | 1.299 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.301(lit.) | | Fp | 35 °F | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | Specific Gravity | 1.299 | | color | Colorless to Almost colorless | | BRN | 1779789 | | InChI | InChI=1S/C5H5F5O2/c1-2-12-3(11)4(6,7)5(8,9)10/h2H2,1H3 | | InChIKey | DBOFMRQAMAZKQY-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 426-65-3(CAS DataBase Reference) | | EPA Substance Registry System | Ethyl perfluoropropionate (426-65-3) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-33-36 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29159000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl pentafluoropropionate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethyl pentafluoropropionate has been used:
- as pentafluoroethyl source in the direct synthesis of pentafluoroethyl copper (CuC2F5)
- in the synthesis of C-6 substituted fluoroalkenyl 2,4-dimethoxypyrimidine derivative
|
| | Ethyl pentafluoropropionate Preparation Products And Raw materials |
| Preparation Products | Ethyl pentafluoropropionylacetate-->Methyl pentafluoropropionate-->2,2,3,3,3-Pentafluoro-1-(3-methoxyphenyl)propan-1-one-->1,1,1,5,5,6,6,6-Octafluoro-2,4-hexanedione |
|