| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1,6-Dioxaspiro[4.4]nonane-2,7-dione manufacturers
|
| | 1,6-Dioxaspiro[4.4]nonane-2,7-dione Basic information |
| Product Name: | 1,6-Dioxaspiro[4.4]nonane-2,7-dione | | Synonyms: | 4,4-DIHYDROXYPIMELIC ACID DILACTONE;SPIRODILACTONE;1,6-Dioxaspiro[4.4]nonane-2,7-dione 98%;gamma-ketopimelic acid dilactone;4,4-Dihydroxypimelic acid dilactone, Spirodilactone;1,6-dioxaspiro[4.4]nonane-2,7-quinone;1,6-Dioxaspiro[4.4]nonane-2,7-dione 98%;1,6-Dioxaspiro[4.4]nonane-2,7-dione | | CAS: | 3505-67-7 | | MF: | C7H8O4 | | MW: | 156.14 | | EINECS: | 222-499-6 | | Product Categories: | | | Mol File: | 3505-67-7.mol | ![1,6-Dioxaspiro[4.4]nonane-2,7-dione Structure](CAS/GIF/3505-67-7.gif) |
| | 1,6-Dioxaspiro[4.4]nonane-2,7-dione Chemical Properties |
| Melting point | 69-71 °C(lit.) | | Boiling point | 170 °C(Press: 1 Torr) | | density | 1.36±0.1 g/cm3(Predicted) | | form | solid | | BRN | 128330 | | InChI | InChI=1S/C7H8O4/c8-5-1-3-7(10-5)4-2-6(9)11-7/h1-4H2 | | InChIKey | VTQYOGUFKHVWOO-UHFFFAOYSA-N | | SMILES | O1C2(CCC(=O)O2)CCC1=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,6-Dioxaspiro[4.4]nonane-2,7-dione Usage And Synthesis |
| Uses | 1,6-Dioxaspiro[4.4]nonane-2,7-dione was used to cure diglycidylether of bisphenol A (DGEBA) with ytterbium triflate as initiator. |
| | 1,6-Dioxaspiro[4.4]nonane-2,7-dione Preparation Products And Raw materials |
|