|
|
| | 2,6-DIAMINOPURINE ARABINOSIDE Basic information |
| Product Name: | 2,6-DIAMINOPURINE ARABINOSIDE | | Synonyms: | 2-Amino-arabinoadenosine;9-(beta-D-arabinofuranosyl)-9H-purine-2,6-diamine;9-β-D-Arabinofuranosyl-2,6-diamino-9H-purine;9-β-D-Arabinofuranosyl-9H-purine-2,6-diamine;9H-Purine-2,6-diaMine, 9-b-D-arabinofuranosyl-;2,6-Diamino-9-(β-D-arabinofuranosyl)purine;2,6-Diaminopurine-9-arabinoside;9-(β-D-arabinofuranosyl)-2,6-Diamino-purine | | CAS: | 34079-68-0 | | MF: | C10H14N6O4 | | MW: | 282.26 | | EINECS: | | | Product Categories: | | | Mol File: | 34079-68-0.mol |  |
| | 2,6-DIAMINOPURINE ARABINOSIDE Chemical Properties |
| Melting point | 286-290°C | | Boiling point | 798.5±70.0 °C(Predicted) | | density | 2.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Slightly, Sonicated), DMSO (Slightly, Heated, Sonicated), Water (Slightly, Sonicated) | | pka | 13.10±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]22/D +28.5°, c = 0.5% in hydrochloric acid | | Stability: | Hygroscopic | | InChI | InChI=1/C10H14N6O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H4,11,12,14,15)/t3-,5-,6+,9-/s3 | | InChIKey | ZDTFMPXQUSBYRL-VOSPVXAENA-N | | SMILES | C12N=C(N=C(N)C=1N=CN2[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1)N |&1:10,11,13,15,r| |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 |
| | 2,6-DIAMINOPURINE ARABINOSIDE Usage And Synthesis |
| Uses | 2,6-Diaminopurine arabinoside is used in preparation methods and devices for canine herpesvirus 1 (CHV-1) detection and prevention. |
| | 2,6-DIAMINOPURINE ARABINOSIDE Preparation Products And Raw materials |
|