|
|
| Product Name: | PCP-D5 | | Synonyms: | 1-(1-(PHENYL-D5)-CYCLOHEXYL)PIPERIDINE;PHEN-D5-CYCLIDINE;PHENCYCLIDINE-D5;PCP-D5;1-(1-(Phenyl-d5)-cyclohexyl)piperidine solution, PCP-d5 solution;Phencyclidine-d5 solution;PCP-D5 (Phencyclidine-D5);PCP-D5 (Phencyclidine-D5) solution
| | CAS: | 60124-86-9 | | MF: | C17H25N | | MW: | 243.39 | | EINECS: | | | Product Categories: | | | Mol File: | 60124-86-9.mol |  |
| | PCP-D5 Chemical Properties |
| Fp | 11 °C | | storage temp. | 2-8°C | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2/i1D,4D,5D,10D,11D | | InChIKey | JTJMJGYZQZDUJJ-ZWYOJXJXSA-N | | SMILES | N3(CCCCC3)C2(CCCCC2)c1c(c(c(c(c1[2H])[2H])[2H])[2H])[2H] |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 36/37-45-16-7 | | RIDADR | UN 1230 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | PCP-D5 Usage And Synthesis |
| Uses | Labelled Phencyclidine (P295500). Anesthetic (intravenous). Controlled substance (depressant). |
| | PCP-D5 Preparation Products And Raw materials |
|