| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | AMITRIPTYLINE METABOLITE (+/-)- Basic information |
| Product Name: | AMITRIPTYLINE METABOLITE (+/-)- | | Synonyms: | (11E)-11-[3-(dimethylamino)propylidene]-5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-5-ol;AMITRIPTYLINE METABOLITE (+/-)-;AMITRIPTYLINE METABOLITE (+-)-(E)-10-HYD ROXYLA;5H-Dibenzo[a,d]cyclohepten-10-ol, 5-[3-(dimethylamino)propylidene]-10,11-dihydro-, (5E)-;10-Hydroxy (E)-Amitriptyline;Amitriptyline metabolite, (±)-E-10-hydroxylated-;(E)-5-(3-(Dimethylamino)propylidene)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-10-ol;(E)-10-Hydroxy amitriptyline | | CAS: | 64520-05-4 | | MF: | C20H23NO | | MW: | 293.4 | | EINECS: | | | Product Categories: | | | Mol File: | 64520-05-4.mol |  |
| | AMITRIPTYLINE METABOLITE (+/-)- Chemical Properties |
| Melting point | 97-99 °C | | Boiling point | 453.3±45.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | 0.1 M HCl: soluble | | form | solid | | pka | 13.89±0.20(Predicted) | | color | white | | Stability: | Hygroscopic | | InChI | 1S/C20H23NO/c1-21(2)13-7-12-17-16-9-4-3-8-15(16)14-20(22)19-11-6-5-10-18(17)19/h3-6,8-12,20,22H,7,13-14H2,1-2H3/b17-12+ | | InChIKey | GHWBJXOKAFHZAI-SFQUDFHCSA-N | | SMILES | CN(C)CC\C=C1/c2ccccc2CC(O)c3ccccc13 | | EPA Substance Registry System | 5H-Dibenzo[a,d]cyclohepten-10-ol, 5-[3-(dimethylamino)propylidene]-10,11-dihydro-, (5E)- (64520-05-4) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AMITRIPTYLINE METABOLITE (+/-)- Usage And Synthesis |
| Uses | (5E)-5-[3-(dimethylamino)propylidene]-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-10-ol is a metabolite of amitriptyline (A633350) which is a dibenzocycloheptadiene derivative and an antidepressant (1). Amitriptyline is also a TrkA and TrkB receptor agonist and exhibits neurotrophic and anti-inflammatory activities (2,3). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA). | | Definition | ChEBI: E-10-Hydroxyamitriptyline is an organic tricyclic compound. | | Biochem/physiol Actions | Metabolite of amitriptyline, tricyclic antidepressant; chromatographic standard. |
| | AMITRIPTYLINE METABOLITE (+/-)- Preparation Products And Raw materials |
|