| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:L-TRYPTOPHAN (13C11, 99%; 15N2, 99%)
CAS:202406-50-6
Purity:98% Package:0.1G Remarks:CNLM-2475-H-0.1
|
| Company Name: |
Reer Technology (Shanghai) Co., LTD
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:L-TRYPTOPHAN(13C11, 99%; 15N2, 99%)
CAS:202406-50-6
Purity:98% Package:0.1 G Remarks:CNLM-2475-H-0.1
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
cindy.yang@lgcgroup.com |
| Products Intro: |
Product Name:L-Tryptophan-13C11-15N2
CAS:202406-50-6
Purity:具体纯度，见COA Package:10mg Remarks:TRC-T202406
|
| Company Name: |
CHINA ISOTOPE CO., LIMITED
|
| Tel: |
02151600108 13062666369 |
| Email: |
info@isotopechem.com |
| Products Intro: |
Product Name:L-TRYPTOPHAN (13C11, 99%; 15N2, 99%)
CAS:202406-50-6
Purity:98% Package:0.1 G Remarks:CNLM-2475-H-0.1
|
|
| | L-Tryptophan-13C11,15N2 Basic information |
| Product Name: | L-Tryptophan-13C11,15N2 | | Synonyms: | L-TRYPTOPHAN-13C11 15N2 97 ATOM % 13C&;L-Tryptophan-13C11,15N2 >=99 atom %, >=98% (CP);L-TRYPTOPHAN-13C11,15N2;L-Tryptophan-13C??,1?N?;L-Tryptophan-13C11,15N2 | | CAS: | 202406-50-6 | | MF: | C11H12N2O2 | | MW: | 204.22518 | | EINECS: | | | Product Categories: | | | Mol File: | 202406-50-6.mol |  |
| | L-Tryptophan-13C11,15N2 Chemical Properties |
| Melting point | 280-285 °C (dec.) (lit.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Acid (Slightly), Water (Slightly, Heated, Sonicated) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D -30.5°, c =1 in H2O | | Stability: | Hygroscopic | | InChI | 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1 | | InChIKey | QIVBCDIJIAJPQS-ODOYFPBQSA-N | | SMILES | [15NH2][13C@@H]([13CH2][13c]1[13cH][15nH][13c]2[13cH][13cH][13cH][13cH][13c]12)[13C](O)=O | | CAS Number Unlabeled | 73-22-3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Tryptophan-13C11,15N2 Usage And Synthesis |
| Uses | L-Tryptophan-13C11-15N2 is the labelled form of L-Tryptophan which is an essential amino acid. |
| | L-Tryptophan-13C11,15N2 Preparation Products And Raw materials |
|