| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2 4-Diamino-6-(4-methylphenyl)-1 3 5- Basic information |
| Product Name: | 2 4-Diamino-6-(4-methylphenyl)-1 3 5- | | Synonyms: | JR-6729, 6-p-Tolyl-1,3,5-triazine-2,4-diamine, 97%;2,4-Diamino-6-(4-methylphenyl)-1,3,5-triazine, 4-(4,6-Diamino-1,3,5-triazin-2-yl)toluene;6-(4-Methylphenyl)-1,3,5-triazine-2,4-diamine;1,3,5-Triazine-2,4-diaMine, 6-(4-Methylphenyl)-;2,4-Diamino-6-(4-methylphenyl)-1,3,5-triazine;2 4-Diamino-6-(4-methylphenyl)-1 3 5- | | CAS: | 19338-12-6 | | MF: | C10H11N5 | | MW: | 201.23 | | EINECS: | | | Product Categories: | Triazines;Heterocyclic Compounds;Building Blocks;Heterocyclic Building Blocks | | Mol File: | 19338-12-6.mol |  |
| | 2 4-Diamino-6-(4-methylphenyl)-1 3 5- Chemical Properties |
| Melting point | 239.5-243.5 °C (lit.) | | form | solid | | color | White to off white | | Sensitive | Air Sensitive | | InChI | 1S/C10H11N5/c1-6-2-4-7(5-3-6)8-13-9(11)15-10(12)14-8/h2-5H,1H3,(H4,11,12,13,14,15) | | InChIKey | DECZZKFYYMMMCQ-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)-c2nc(N)nc(N)n2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 29336990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2 4-Diamino-6-(4-methylphenyl)-1 3 5- Usage And Synthesis |
| | 2 4-Diamino-6-(4-methylphenyl)-1 3 5- Preparation Products And Raw materials |
|