| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 1 1'-Diethyl-4 4'-dicarbocyanine iodide Basic information |
| | 1 1'-Diethyl-4 4'-dicarbocyanine iodide Chemical Properties |
| Melting point | 158 °C (dec.)(lit.) | | form | solid | | λmax | 814 nm | | InChI | 1S/C27H27N2.HI/c1-3-28-20-18-22(24-14-8-10-16-26(24)28)12-6-5-7-13-23-19-21-29(4-2)27-17-11-9-15-25(23)27;/h5-21H,3-4H2,1-2H3;1H/q+1;/p-1 | | InChIKey | XDGZLJIBGBJNTI-UHFFFAOYSA-M | | SMILES | [I-].CCN1C=C\C(=C/C=C/C=C/c2cc[n+](CC)c3ccccc23)c4ccccc14 |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 22-26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1 1'-Diethyl-4 4'-dicarbocyanine iodide Usage And Synthesis |
| Description | 1,1'-Diethyl-4,4'-dicarbocyanine iodide An extensively utilized fluorescent dye within the biomedical research community, serving as a vital tool for the visualization and marking of nucleic acids, membranes, and proteins. Its application extends to the investigation of mitochondrial activity and cellular health in pathological conditions, including cancer and neurodegenerative ailments. |
| | 1 1'-Diethyl-4 4'-dicarbocyanine iodide Preparation Products And Raw materials |
|