| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Bromo-5-carboxybenzeneboronic acid 97 Basic information |
| | 3-Bromo-5-carboxybenzeneboronic acid 97 Chemical Properties |
| Melting point | 290-292 | | Boiling point | 480.7±55.0 °C(Predicted) | | density | 1.86±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.82±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C7H6BBrO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,12-13H,(H,10,11) | | InChIKey | CWBLIPMCDMSOFX-UHFFFAOYSA-N | | SMILES | OB(O)c1cc(Br)cc(c1)C(O)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2931900090 | | Storage Class | 13 - Non Combustible Solids |
| | 3-Bromo-5-carboxybenzeneboronic acid 97 Usage And Synthesis |
| | 3-Bromo-5-carboxybenzeneboronic acid 97 Preparation Products And Raw materials |
|