| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-alpha-Funebrene Basic information |
| Product Name: | (+)-alpha-Funebrene | | Synonyms: | (+)-1,7-diepi-α-cedrene;(+)-α-funebrene;2,3,4,7,8,8aβ-Hexahydro-3β,6,8,8-tetramethyl-1H-3aβ,7β-methanoazulene;(+)-alpha-Funebrene >=95.0% (sum of enantiomers, GC);1H-3a,7-Methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, (3R,3aR,7R,8aS)-;(+)-alpha-Funebrene;(+)-α-Funebrene | | CAS: | 50894-66-1 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | 50894-66-1.mol |  |
| | (+)-alpha-Funebrene Chemical Properties |
| Boiling point | 252 °C(lit.) | | density | 0.925 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.495 | | storage temp. | 2-8°C | | Optical Rotation | [α]20/D +103±1°, neat | | InChI | 1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12-,13+,15-/m1/s1 | | InChIKey | IRAQOCYXUMOFCW-GUIRCDHDSA-N | | SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@@H]3C[C@]12CC=C3C |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10-23 | | Storage Class | 12 - Non Combustible Liquids |
| | (+)-alpha-Funebrene Usage And Synthesis |
| | (+)-alpha-Funebrene Preparation Products And Raw materials |
|