(TRIPHENYLSILYL)ACETYLENE 98 manufacturers
|
| | (TRIPHENYLSILYL)ACETYLENE 98 Basic information |
| | (TRIPHENYLSILYL)ACETYLENE 98 Chemical Properties |
| Melting point | 48-50 °C (lit.) | | Boiling point | 146-149 °C(Press: 0.03 Torr) | | density | 1.07±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | 1S/C20H16Si/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h1,3-17H | | InChIKey | WADKYPSVXRWORK-UHFFFAOYSA-N | | SMILES | C#C[Si](c1ccccc1)(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (TRIPHENYLSILYL)ACETYLENE 98 Usage And Synthesis |
| Uses | (Triphenylsilyl)acetylene may be used in the synthesis of:
- selenothioic acid S-alkyl esters
- methyl 2-(di{ 3, 5-bis[(triphenylsilyl)ethynyl]phenyl}-phosphino)benzoate
- 2-(di{3,5-bis[(triphenylsilyl)ethynyl]phenyl}-phosphino)benzoic acid
| | General Description | (Triphenylsilyl)acetylene is a terminal alkyne. Rhodium-catalyzed asymmetric addition of (triphenylsilyl)acetylene to diphenylphosphinylallene is reported. |
| | (TRIPHENYLSILYL)ACETYLENE 98 Preparation Products And Raw materials |
|