| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
9 9-Dioctylfluorene-2 7-diboronic acid manufacturers
|
| | 9 9-Dioctylfluorene-2 7-diboronic acid Basic information |
| Product Name: | 9 9-Dioctylfluorene-2 7-diboronic acid | | Synonyms: | 9,9-Dioctylfluorene-2,7-diboronic acid,98%;9 9-dioctylfluorene-2 7-diboronic acid ,≥96%;Boronic acid, B,B'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis-;9,9-dioctyl-1H,9H-fluoreno[1,2-c][1,2]oxaboret-1-ol;(7-borono-9,9-dioctyl-2-fluorenyl)boronic acid;9,9-Di-n-octylfluorene-2,7-diboronic acid, 97%;9,9-dioctyl-9H-fluorene-2,7-diyldiboronic acid;9,9-Dioctylfluorene-2,7-diboronic acid 96% | | CAS: | 258865-48-4 | | MF: | C29H44B2O4 | | MW: | 478.28 | | EINECS: | | | Product Categories: | Fluorene;Organoborons;Aryl;Boronic Acids;Boronic Acids and Derivatives;blocks;BoronicAcids | | Mol File: | 258865-48-4.mol |  |
| | 9 9-Dioctylfluorene-2 7-diboronic acid Chemical Properties |
| Melting point | 158-162 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to off-white | | InChI | 1S/C29H44B2O4/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(30(32)33)15-17-25(27)26-18-16-24(31(34)35)22-28(26)29/h15-18,21-22,32-35H,3-14,19-20H2,1-2H3 | | InChIKey | HURJMQMZDPOUOU-UHFFFAOYSA-N | | SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(ccc2-c3ccc(cc13)B(O)O)B(O)O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 9 9-Dioctylfluorene-2 7-diboronic acid Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 9,9-Dioctylfluorene-2,7-diboronic acid can be used as a reactant to synthesize hyperbranched conjugated conductive copolymers by Pd-catalyzed Suzuki-Miyaura cross coupling (SMC) copolymerization reaction with different dibromoarenes. |
| | 9 9-Dioctylfluorene-2 7-diboronic acid Preparation Products And Raw materials |
|