|
|
| | 3-Amino-4,5-dimethylisoxazole Basic information |
| Product Name: | 3-Amino-4,5-dimethylisoxazole | | Synonyms: | dimethyl-1,2-oxazol-3-amine;3-amino-4,5-dimethylisoxazole;4,5-dimethyl-1,2-oxazol-3-amine;4,5-Dimethylisoxazol-3-amine;3-AMINO-4,5-DIMETHYLISOXAZOLE 98%;(4,5-dimethylisoxazol-3-yl)amine;4,5-Dimethyl-3-aminoisoxazole;3-IsoxazolaMine, 4,5-diMethyl- | | CAS: | 13999-39-8 | | MF: | C5H8N2O | | MW: | 112.13 | | EINECS: | 237-802-7 | | Product Categories: | | | Mol File: | 13999-39-8.mol |  |
| | 3-Amino-4,5-dimethylisoxazole Chemical Properties |
| Melting point | 115-117 °C | | Boiling point | 250.0±35.0 °C(Predicted) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 2.26±0.10(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C5H8N2O/c1-3-4(2)8-7-5(3)6/h1-2H3,(H2,6,7) | | InChIKey | VPANVNSDJSUFEF-UHFFFAOYSA-N | | SMILES | O1C(C)=C(C)C(N)=N1 | | CAS DataBase Reference | 13999-39-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Amino-4,5-dimethylisoxazole Usage And Synthesis |
| Uses | 3-Amino-4,5-Dimethylisoxazole is an isoxazole derivative used in the preparation of a varitey of biologically active compounds such as selective ETA receptor antagonists. | | Uses | 4,5-Dimethyl-3-isoxazolamine is an isoxazole derivative used in the preparation of a varitey of biologically active compounds such as selective ETA receptor antagonists. |
| | 3-Amino-4,5-dimethylisoxazole Preparation Products And Raw materials |
|