| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Diethyl 2-butenylphosphonate 95 Basic information |
| Product Name: | Diethyl 2-butenylphosphonate 95 | | Synonyms: | crotyl phosphonate de diethyle;diethyl 2-butenylphosphonate, predominantly trans;Diethyl 2-Buten-1-ylphosphonate;Phosphonic acid, 2-butenyl-, diethyl ester (7CI,8CI,9CI);Diethyl but-2-en-1-ylphosphonate;Diethyl 2-butenylphosphonate, predominantly trans;Diethyl 2-butenylphosphonate 95 | | CAS: | 682-34-8 | | MF: | C8H17O3P | | MW: | 192.19 | | EINECS: | | | Product Categories: | | | Mol File: | 682-34-8.mol |  |
| | Diethyl 2-butenylphosphonate 95 Chemical Properties |
| Boiling point | 100.5 °C(Press: 7 Torr) | | density | 1.014 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4400(lit.) | | Fp | 219 °F | | InChI | 1S/C8H17O3P/c1-4-7-8-12(9,10-5-2)11-6-3/h4,7H,5-6,8H2,1-3H3/b7-4+ | | InChIKey | KGWLPYVMUWAOJC-QPJJXVBHSA-N | | SMILES | [H]\C(C)=C(\[H])CP(=O)(OCC)OCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Diethyl 2-butenylphosphonate 95 Usage And Synthesis |
| Uses | Olefinic partner for Pauson-Khand reaction with alkyne cobalt complex
Reactant for:
- Synthesis of di-Et 1-substituted vinylphosphonates via decarboxylative condensation
- Sequential lithiation and silylation
- Palladium catalyzed allylic acetoxylation
- Preparation of building blocks of retinoid chemistry
| | reaction suitability | reaction type: C-C Bond Formation |
| | Diethyl 2-butenylphosphonate 95 Preparation Products And Raw materials |
|