| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(4-Formylphenoxy)benzaldehyde 96 Basic information |
| Product Name: | 4-(4-Formylphenoxy)benzaldehyde 96 | | Synonyms: | JR-8229, 4-(4-Formylphenoxy)benzaldehyde, 97%;Benzaldehyde,4,4'-oxybis-;4,4μ-Diformyldiphenyl ether, 4,4μ-Oxybis(benzaldehyde), 4,4μ-Oxydibenzaldehyde, Bis(4-formylphenyl) ether;4-(4-ForMylphenoxy)benzaldehyde 96%;4,4'-Oxydibenzaldehyde;4,4'-Oxybis[benzaldehyde;4-(4-Formylphenoxy)benzaldehyde 96 | | CAS: | 2215-76-1 | | MF: | C14H10O3 | | MW: | 226.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2215-76-1.mol |  |
| | 4-(4-Formylphenoxy)benzaldehyde 96 Chemical Properties |
| Melting point | 63-67 °C | | Boiling point | 160°C/0.1mmHg(lit.) | | density | 1.233 | | storage temp. | 2-8°C, stored under nitrogen | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C14H10O3/c15-9-11-1-5-13(6-2-11)17-14-7-3-12(10-16)4-8-14/h1-10H | | InChIKey | GXZZHLULZRMUQC-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(Oc2ccc(cc2)C([H])=O)cc1 |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 2 | | HS Code | 2912490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Sens. 1 |
| | 4-(4-Formylphenoxy)benzaldehyde 96 Usage And Synthesis |
| | 4-(4-Formylphenoxy)benzaldehyde 96 Preparation Products And Raw materials |
|