L-Carnitine-d3 HCl (methyl-d3) manufacturers
|
| | L-Carnitine-d3 HCl (methyl-d3) Basic information |
| Product Name: | L-Carnitine-d3 HCl (methyl-d3) | | Synonyms: | [(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium;L-Carnitine -D3CI (methyl-D3);L-Carnitine-d3 HCl;L-Carnitine-d3 HCl (N-methyl-d3);L-Carnitine-d3 Chloride;L-Carnitine -D3HCI (methyl-D3);L-CARNITINE:HCL (METHYL-D3, 98%);[2H3]- L-Carnitine Chloride | | CAS: | 350818-62-1 | | MF: | C6H10D3NO3.ClH | | MW: | 186.652 | | EINECS: | | | Product Categories: | | | Mol File: | 350818-62-1.mol |  |
| | L-Carnitine-d3 HCl (methyl-d3) Chemical Properties |
| Melting point | 131-135°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Beige | | Stability: | Hygroscopic | | InChI | 1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H/t6-;/m1./s1/i1D3; | | InChIKey | JXXCENBLGFBQJM-QKBJTWEASA-N | | SMILES | [Cl-].[2H]C([2H])([2H])[N+](C)(C)C[C@H](O)CC(O)=O | | CAS Number Unlabeled | 6645-46-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | L-Carnitine-d3 HCl (methyl-d3) Usage And Synthesis |
| Uses | L-Carnitine-d3 Chloride is the isotope labelled analog of L-Carnitine (C184110); a vitamin (enzyme cofactor). It is an essential cofactor of fatty acid metabolism and is required for the transport of fatty acids through the inner mitochondrial membrane. Synthetized primarily in the liver and kidney with the highest concentrations found in heart and skeletal muscle. Dietary sources include red meat, dairy products, beans, avocado. |
| | L-Carnitine-d3 HCl (methyl-d3) Preparation Products And Raw materials |
|