| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Dihydroactinidiolide
-
- $180.00
-
2025-04-15
- CAS:15356-74-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
|
| | Dihydroactinidiolide Basic information |
| Product Name: | Dihydroactinidiolide | | Synonyms: | (2,6,6-trimethy1-2-hydroxycyclohexylidene)-acetic acid lactone;4,4,7a-Trimethyl-5,6,7,7a-tetrahydro-1-benzofuran-2(4H)-one;4,5,7,7a-Tetrahydro-4,4,7a-trimethyl-2(6H)benzofuranone;4,4,7a-Trimethyl-2,4,5,6,7,7a-hexahydrobenzofuran-2-one;2,4,5,6,7,7a-Hexahydro-4,4,7a-trimethylbenzofuran-2-one;2-Hydroxy-2,6,6-trimethylcyclohexylidene-1-acetic acid lactone;5,8,7,7-Tetrahydro-4,4,7a-trimethyl-alpha-benzofuranone;(S)-4,4,7a-TriMethyl-5,6,7,7a-tetrahydrobenzofuran-2(4H)-one | | CAS: | 15356-74-8 | | MF: | C11H16O2 | | MW: | 180.24 | | EINECS: | 239-390-4 | | Product Categories: | | | Mol File: | 15356-74-8.mol |  |
| | Dihydroactinidiolide Chemical Properties |
| Melting point | 42-43° | | Boiling point | 296℃ | | density | 1.05 | | FEMA | 4020 | (+/-)-(2,6,6-TRIMETHYL-2-HYDROXYCYCLOHEXYLIDENE)ACETIC ACID GAMMA-LACTONE | | Fp | 120℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White | | Odor | at 100.00 %. ripe apricot fruity plum berry grape tropical fruit woody | | Odor Type | fruity | | JECFA Number | 1164 | | InChI | InChI=1S/C11H16O2/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11/h7H,4-6H2,1-3H3 | | InChIKey | IMKHDCBNRDRUEB-UHFFFAOYSA-N | | SMILES | O1C2(C)CCCC(C)(C)C2=CC1=O | | LogP | 2.26 | | EPA Substance Registry System | 2(4H)-Benzofuranone, 5,6,7,7a-tetrahydro-4,4,7a-trimethyl- (15356-74-8) |
| | Dihydroactinidiolide Usage And Synthesis |
| Chemical Properties | (+/–)-(2,6,6-Trimethyl-2-hydroxycyclohexylidene) acetic acid gamma-lactone has a powerful musky or coumarin like
odor. As this compound is formed from photooxidation of carotene-like structures, its taste is related to certain fruit types at their
peak of ripeness. | | Occurrence | Reportedly present in lemongrass and sweet grass oil. | | Uses | DIHYDROACTINIDIOLIDE is widely used in tobacco flavorings, beverage and other food flavoring formulations, and pharmaceutical intermediates. | | Definition | ChEBI: Dihydroactinidiolide is a member of benzofurans. | | Preparation | Prepared in a patented process by degradation of beta-carotene in the presence of nitrogen and air. |
| | Dihydroactinidiolide Preparation Products And Raw materials |
|