SJA710-6 manufacturers
- SJA710-6
-
- $54.00
-
2026-08-08
- CAS:1397255-09-2
- Purity: 99.96%
- Supply Ability: 10g
|
| | SJA710-6 Basic information |
| Product Name: | SJA710-6 | | Synonyms: | SJA 710-6;SJA710 6;SJA710 6; SJA710-6; SJA-710-6; SJA 710-6;SJA-710-6;SJA710-6;3H-Imidazo[4,5-b]pyridin-5-amine, 2-(4-bromophenyl)-N-[(4-fluorophenyl)methyl]-3-propyl-;SJA-710-6,Inhibitor,inhibit,SJA7106,SJA710-6,SJA710 6;2-(4-bromophenyl)-N-[(4-fluorophenyl)methyl]-3-propyl-3H-imidazo[4,5-b]pyridin-5-amine | | CAS: | 1397255-09-2 | | MF: | C22H20BrFN4 | | MW: | 439.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1397255-09-2.mol |  |
| | SJA710-6 Chemical Properties |
| Boiling point | 577.0±60.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 250 mg/mL ; Water : < 0.1 mg/mL | | form | Solid | | pka | 4.51±0.30(Predicted) | | color | White to off-white | | SMILES | BrC(C=C1)=CC=C1C2=NC3=C(N2CCC)N=C(NCC4=CC=C(F)C=C4)C=C3 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | SJA710-6 Usage And Synthesis |
| Uses | SJA710-6 is a small molecule able to selectively differentiate MSCs toward hepatocyte-like cells[1]. | | Biological Activity | Cell permeable: yes', 'Reversible: yes | | References | [1] Hepatic differentiation of rat mesenchymal stem cells by a small molecule. Ouyang J, et al. ChemMedChem. 2012 Aug;7(8):1447-52. DOI:10.1002/cmdc.201200162 |
| | SJA710-6 Preparation Products And Raw materials |
|