| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Ceftazidime Impurity 4
CAS:73547-69-0
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Ceftazidime EP ImpurityD
CAS:73547-69-0
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
| Products Intro: |
Product Name:Ceftazidime EP Impurity D
CAS:73547-69-0
Purity:98%以上 Package:10mg;50mg;100mg等多种规格 Remarks:REF-C13004
|
Ceftazidime EP Impurity D manufacturers
|
| | Ceftazidime EP Impurity D Basic information |
| Product Name: | Ceftazidime EP Impurity D | | Synonyms: | Ceftazidime EP Impurity D;2-(1-(Tert-butoxy)-1-oxo)-2-(5-trityl) Ceftazidime;(6R,7R)-7-((Z)-2-(((1-(Tert-butoxy)-2-methyl-1-oxopropan-2-yl)oxy)imino)-2-(2-(tritylamino)thiazol-4-yl)acetamido)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate? (Ceftazidime Impurity) | | CAS: | 73547-69-0 | | MF: | C45H44N6O7S2 | | MW: | 845 | | EINECS: | | | Product Categories: | | | Mol File: | 73547-69-0.mol |  |
| | Ceftazidime EP Impurity D Chemical Properties |
| InChIKey | TZPCYDMMCQSRRI-VKSWUZDPNA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)NC1SC=C(/C(=N/OC(C)(C)C(=O)OC(C)(C)C)/C(=O)N[C@@H]2C(=O)N3C(=C(C[N+]4=CC=CC=C4)CS[C@]23[H])C(=O)[O-])N=1 |&1:40,55,r| |
| | Ceftazidime EP Impurity D Usage And Synthesis |
| Uses | 2-(1-(Tert-butoxy)-1-oxo)-2-(5-trityl) Ceftazidime is the impurity of Ceftazidime. Ceftazidime Third generation cephalosporin antibiotic. Antibacterial. |
| | Ceftazidime EP Impurity D Preparation Products And Raw materials |
|