| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Benzenethiol, 2,4,6-tris(1-methylethyl)- Basic information |
| | Benzenethiol, 2,4,6-tris(1-methylethyl)- Chemical Properties |
| Boiling point | 81 °C(Press: 0.2 Torr) | | density | 0.937±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 7.11±0.50(Predicted) | | Appearance | Colorless to off-white Liquid | | InChI | InChI=1S/C15H24S/c1-9(2)12-7-13(10(3)4)15(16)14(8-12)11(5)6/h7-11,16H,1-6H3 | | InChIKey | QLPCAAJSEQIZOP-UHFFFAOYSA-N | | SMILES | C1(S)=C(C(C)C)C=C(C(C)C)C=C1C(C)C |
| | Benzenethiol, 2,4,6-tris(1-methylethyl)- Usage And Synthesis |
| | Benzenethiol, 2,4,6-tris(1-methylethyl)- Preparation Products And Raw materials |
|