|
|
| | 4H-Cyclohepta[b]thiophene-3-carboxylic acid, 2-amino-5,6,7,8-tetrahydro- Basic information |
| | 4H-Cyclohepta[b]thiophene-3-carboxylic acid, 2-amino-5,6,7,8-tetrahydro- Chemical Properties |
| Melting point | 100-101 °C | | Boiling point | 426.0±45.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | pka | 5.67±0.20(Predicted) | | InChI | 1S/C10H13NO2S/c11-9-8(10(12)13)6-4-2-1-3-5-7(6)14-9/h1-5,11H2,(H,12,13) | | InChIKey | ZEEOZLWBPKOHFR-UHFFFAOYSA-N | | SMILES | NC1=C(C(O)=O)C(CCCCC2)=C2S1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4H-Cyclohepta[b]thiophene-3-carboxylic acid, 2-amino-5,6,7,8-tetrahydro- Usage And Synthesis |
| | 4H-Cyclohepta[b]thiophene-3-carboxylic acid, 2-amino-5,6,7,8-tetrahydro- Preparation Products And Raw materials |
|