| Company Name: |
Shaanxi Pioneer Biotech Co.,Ltd
|
| Tel: |
029-84385017-8001 18220517932 |
| Email: |
sales@pioneerbiotech.com |
| Products Intro: |
Product Name:Ergothioneine
Purity:0.99 Package:1kg;25kg;100kg
|
| Company Name: |
Shaanxi Pioneer Biotech Co.,Ltd.
|
| Tel: |
029-84385017-8011 15202491660 |
| Email: |
sales8@pioneerbiotech.com |
| Products Intro: |
Product Name:L-Ergothioneine
Purity:99.9% Remarks:25kgg,kg
|
|
| | ERGOTHIONEINE Basic information |
| Product Name: | ERGOTHIONEINE | | Synonyms: | thiohistidinebetaine;thiolhistidine betain | | CAS: | | | MF: | C9H15N3O2S | | MW: | 229.3 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | ERGOTHIONEINE Chemical Properties |
| InChI | InChI=1S/C9H15N3O2S/c1-12(2,3)7(8(13)14)4-6-5-10-9(15)11-6/h5,7H,4H2,1-3H3,(H2-,10,11,13,14,15) | | InChIKey | SSISHJJTAXXQAX-UHFFFAOYSA-N | | SMILES | [N+](C)(C)(C)C(CC1=CN=C(S)N1)C([O-])=O |
| | ERGOTHIONEINE Usage And Synthesis |
| | ERGOTHIONEINE Preparation Products And Raw materials |
|