Bis(4-methyl-2-pentyl)phthalate manufacturers
|
| | Bis(4-methyl-2-pentyl)phthalate Basic information |
| Product Name: | Bis(4-methyl-2-pentyl)phthalate | | Synonyms: | PHTHALIC ACID, BIS-4-METHYL-2-PENTYL ESTER;1,2-Benzenedicarboxylicaci;PHTHALICACIDDIISOHEXYLESTER;1,2-Benzenedicarboxylic acid bis(4-methylpentyl) ester;Phthalic acid di(4-methylpentyl) ester;benzene-1,2-dicarboxylic acid diisohexyl ester;DI 4-METHYL-2-PENTYL PHTHALATE;bis(4-methylpentyl) benzene-1,2-dicarboxylate | | CAS: | 146-50-9 | | MF: | C20H30O4 | | MW: | 334.45 | | EINECS: | | | Product Categories: | | | Mol File: | 146-50-9.mol |  |
| | Bis(4-methyl-2-pentyl)phthalate Chemical Properties |
| InChI | InChI=1S/C20H30O4/c1-13(2)11-15(5)23-19(21)17-9-7-8-10-18(17)20(22)24-16(6)12-14(3)4/h7-10,13-16H,11-12H2,1-6H3 | | InChIKey | UAFXUVUVOTXFND-UHFFFAOYSA-N | | SMILES | C(OC(CC(C)C)C)(=O)C1=CC=CC=C1C(OC(CC(C)C)C)=O | | EPA Substance Registry System | Diisohexyl phthalate (146-50-9) |
| | Bis(4-methyl-2-pentyl)phthalate Usage And Synthesis |
| | Bis(4-methyl-2-pentyl)phthalate Preparation Products And Raw materials |
|