| Company Name: |
JYS Gold |
| Tel: |
13545274181 |
| Email: |
3870253201@qq.com |
Poly(vinylidene chloride-co-vinyl chloride) manufacturers
|
| | Poly(vinylidene chloride-co-vinyl chloride) Basic information |
| | Poly(vinylidene chloride-co-vinyl chloride) Chemical Properties |
| Melting point | 149-191 °C | | density | 1.73 g/mL at 25 °C | | Tg | 90 | | form | powder | | InChI | InChI=1S/C2H2Cl2.C2H3Cl/c1-2(3)4;1-2-3/h1H2;2H,1H2 | | InChIKey | DHZSIQDUYCWNSB-UHFFFAOYSA-N | | SMILES | ClC(=C([H])[H])Cl.ClC([H])=C([H])[H] | | IARC | 3 (Vol. 19, Sup 7) 1987 | | EPA Substance Registry System | Ethene, 1,1-dichloro-, polymer with chloroethene (9011-06-7) |
| Hazard Codes | N,Xn | | Risk Statements | 52/53-40-20 | | Safety Statements | 61-36/37 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed |
| | Poly(vinylidene chloride-co-vinyl chloride) Usage And Synthesis |
| Uses | Vinylidene chloride/vinyl chloride copolymer is used for the manufacture of fibers, films, coatings, etc. | | Definition | ChEBI: Vinylidene chloride-vinyl chloride copolymer is a polymer. | | Synthesis | Vinylidene chloride/vinyl chloride copolymer can be obtained by copolymerizing vinyl chloride and vinylidene chloride emulsion. The production method is similar to that of vinyl chloride homopolymer. | | Solubility in organics | DMF, THF, trichloroethane |
| | Poly(vinylidene chloride-co-vinyl chloride) Preparation Products And Raw materials |
|