|
|
| | 1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine Basic information |
| | 1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine Chemical Properties |
| Melting point | 186 °C | | Boiling point | 506.7±50.0 °C(Predicted) | | density | 1.165±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly) | | form | Solid | | pka | 7.69±0.10(Predicted) | | color | Dark Purple to Dark Grey | | InChI | InChI=1S/C17H21N3O/c1-21-17-8-6-16(7-9-17)20-12-10-19(11-13-20)15-4-2-14(18)3-5-15/h2-9H,10-13,18H2,1H3 | | InChIKey | VXEGSRKPIUDPQT-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(N2CCN(C3=CC=C(OC)C=C3)CC2)C=C1 | | CAS DataBase Reference | 74852-62-3(CAS DataBase Reference) |
| | 1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine Usage And Synthesis |
| Chemical Properties | Purple Solid | | Uses | 4-[4-(4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine, is an intermediate for the synthesis of Itraconazole (I937500), an Antifungal. |
| | 1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine Preparation Products And Raw materials |
|