| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | OMP SODIUM SALT Basic information |
| Product Name: | OMP SODIUM SALT | | Synonyms: | OROTIDINE 5'-MONOPHOSPHATE SODIUM SALT;OROTIDYLIC ACID SODIUM SALT;OMP SODIUM SALT;orotidine 5'-monophosphate trisodium salt;OMP, Orotidylic acid;orotidine 5'-monophosphate trisodium | | CAS: | 68244-58-6 | | MF: | C10H10N2Na3O11P | | MW: | 434.14 | | EINECS: | | | Product Categories: | | | Mol File: | 68244-58-6.mol |  |
| | OMP SODIUM SALT Chemical Properties |
| storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | powder | | color | white | | Stability: | Hygroscopic | | InChI | 1S/C10H13N2O11P.Na.H/c13-5-1-3(9(16)17)12(10(18)11-5)8-7(15)6(14)4(23-8)2-22-24(19,20)21;;/h1,4,6-8,14-15H,2H2,(H,16,17)(H,11,13,18)(H2,19,20,21);; | | InChIKey | PSBNOTIIJINWKE-UHFFFAOYSA-N | | SMILES | [Na].OC1C(O)C(OC1COP(O)(O)=O)N2C(=O)NC(=O)C=C2C(O)=O |
| | OMP SODIUM SALT Usage And Synthesis |
| Uses | Orotidine 5''-Monophosphate Trisodium Salt is synthesized from the reaction of silver salt with MeI and phosphorylated with the cyanoethyl phosphate-dicyclohexylcarbodiimide reagent. | | IC 50 | Human Endogenous Metabolite |
| | OMP SODIUM SALT Preparation Products And Raw materials |
|