| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Bismuth Octoate
-
-
2025-06-20
- CAS:67874-71-9
- Min. Order: 1kg
- Purity: 20%/25%/28%
- Supply Ability: 20tons
|
| | Bismuth 2-ethylhexanoate Basic information |
| | Bismuth 2-ethylhexanoate Chemical Properties |
| density | 1,28 g/cm3 | | vapor pressure | 4Pa at 20℃ | | Fp | 72°C | | form | Liquid | | Specific Gravity | 1.28 | | Water Solubility | Not miscible with water. | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C8H16O2.Bi.3H/c1-3-5-6-7(4-2)8(9)10;;;;/h7H,3-6H2,1-2H3,(H,9,10);;;; | | InChIKey | DPUMEUCFOQDKAX-UHFFFAOYSA-N | | SMILES | C(CC)(C(=O)O)CCCC.[BiH3] | | EPA Substance Registry System | Bismuth(III) 2-ethylhexanoate (67874-71-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 1993 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III |
| Provider | Language |
|
ALFA
| English |
| | Bismuth 2-ethylhexanoate Usage And Synthesis |
| Uses | Paint drier, Lubricant additive, polyurethane catalyst | | Uses | Bismuth 2-ethylhexanoate is used as an industrial lubricant and dessicant. It is also used for synthesizing of urethane foam, urethane coating and other urethane products. | | Flammability and Explosibility | Not classified |
| | Bismuth 2-ethylhexanoate Preparation Products And Raw materials |
|