- muscimol wholesale
-
- $1.00
-
2026-07-07
- CAS:18174-72-6
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 1000
- MUSCIMOL HYDRATE
-
- $1.50
-
2026-05-22
- CAS:18174-72-6
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
|
| | MUSCIMOL HYDRATE Basic information |
| Product Name: | MUSCIMOL HYDRATE | | Synonyms: | MUSCIMOL HYDRATE;5-(aminomethyl)-3(2h)-isoxazolonmonohydrobromide;5-(aminomethyl)-3-isoxazololmonohydrobromide;5-(aminomethyl)-3-isoxazolomonohydrobromide;5-(AMMOMETHYL)-3-ISOXAZOLOL H20;5-(AMINOMETHYL)-3-HYDROXYISOXAZOL HYDRATE;Nsc304080;MUSCIMOL HBR | | CAS: | 18174-72-6 | | MF: | C4H6N2O2.BrH | | MW: | 195.01 | | EINECS: | | | Product Categories: | Enzyme substrates;Neurochemicals | | Mol File: | 18174-72-6.mol |  |
| | MUSCIMOL HYDRATE Chemical Properties |
| Melting point | 172 °C | | storage temp. | 2-8°C | | solubility | ethanol: 1 mg/mL | | form | powder | | color | off-white | | Water Solubility | H2O: >10mg/mL | | Stability: | Store in freezer at -20°C | | InChI | InChI=1S/C4H6N2O2.BrH/c5-2-3-1-4(7)6-8-3;/h1H,2,5H2,(H,6,7);1H | | InChIKey | OPZOJWHOZRKYQX-UHFFFAOYSA-N | | SMILES | C1(CN)ON=C(O)C=1.Br |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 22-36/37/39-45 | | RIDADR | UN 1544 6.1/PG 2 | | WGK Germany | 3 | | RTECS | NY3345000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | MUSCIMOL HYDRATE Usage And Synthesis |
| Description | Muscimol HBr (18174-72-6) is a GABA-A receptor agonist. | | Chemical Properties | Tan Solid | | Uses | A potent but toxic structural analogue of g-aminobutyric acid (GABA), with a zwitterionic structure that can cross the blood-brain barrier. | | Biochem/physiol Actions | Muscimol hydrobromide is a GABAA receptor agonist. | | References | [1] S. AKHONDZADEH T. W S. Induction of a novel form of hippocampal long-term depression by muscimol: involvement of GABAA but not glutamate receptors[J]. British Journal of Pharmacology, 1995, 115 3: 527-533. DOI:10.1111/j.1476-5381.1995.tb16366.x |
| | MUSCIMOL HYDRATE Preparation Products And Raw materials |
|