| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Methyl-5-tributylstannanyl-1H-imidazole Basic information |
| Product Name: | 1-Methyl-5-tributylstannanyl-1H-imidazole | | Synonyms: | 1-Methyl-5-(tributylstannyl)-1H-imidazole 97%;1-METHYL-5-(TRIBUTYLSTANNYL)IMIDAZOLE;1-METHYL-5-(TRIBUTYLSTANNYL)-1H-IMIDAZOLE;1-Methyl-5-(tri-n-butylstannyl)iMidazole, 90+%;(1-Methyl-1H-imidazol-5-yl)tributylstannane;5-Tributylstannyl-N-methylimidazole;1-Methyl-5-(tributylstannyl)iMidazole 95%;1-Methyl-5-(tributylstannyl)-1H-imidazole,tech | | CAS: | 147716-03-8 | | MF: | C16H32N2Sn | | MW: | 371.15 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 147716-03-8.mol |  |
| | 1-Methyl-5-tributylstannanyl-1H-imidazole Chemical Properties |
| density | 1.220 g/mL at 25 °C | | refractive index | n20/D1.510 | | Fp | >110℃ | | storage temp. | Storage temp. 2-8°C | | pka | 6.91±0.22(Predicted) | | form | liquid | | color | Clear, tan | | Water Solubility | Sparingly soluble in water. | | Boiling point | 160-164°C/2 mmHg | | Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 | | InChI | 1S/C4H5N2.3C4H9.Sn/c1-6-3-2-5-4-6;3*1-3-4-2;/h2,4H,1H3;3*1,3-4H2,2H3; | | InChIKey | OGYWKJKAIAEDQX-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cncn1C |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 36/37/39-45-60-61-35 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | 6.1 | | HS Code | 29332900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 1-Methyl-5-tributylstannanyl-1H-imidazole Usage And Synthesis |
| Uses | 1-Methyl-5-(tri-n-butylstannyl)imidazole is used in pharmaceuticals, drug candidates, ligands for transition metal catalysts and other molecular functional materials. |
| | 1-Methyl-5-tributylstannanyl-1H-imidazole Preparation Products And Raw materials |
|