|
|
| | AMIDITHION Basic information |
| Product Name: | AMIDITHION | | Synonyms: | O,O-Dimethyl ester, S-ether-2-mercapto-N-(2-methoxyethyl)acetamide thiophosphonic acid;amidithion (ISO) 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate;2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate;amidiphos (f);amidithion (bsi,iso,esa,ansi);2-dimethoxyphosphinothioylsulfanyl-N-(2-methoxyethyl)acetamide;acetamide,2-mercapto-n-(2-methoxyethyl)-,s-esterwitho,o-dimethylphosphor;amidiphos | | CAS: | 919-76-6 | | MF: | C7H16NO4PS2 | | MW: | 273.31 | | EINECS: | | | Product Categories: | | | Mol File: | 919-76-6.mol |  |
| | AMIDITHION Chemical Properties |
| density | 1.270±0.06 g/cm3(Predicted) | | pka | 13+-.0.46(Predicted) | | InChI | InChI=1S/C7H16NO4PS2/c1-10-5-4-8-7(9)6-15-13(14,11-2)12-3/h4-6H2,1-3H3,(H,8,9) | | InChIKey | GDTZUQIYUMGJRT-UHFFFAOYSA-N | | SMILES | P(=S)(SCC(NCCOC)=O)(OC)OC | | EPA Substance Registry System | Amidithion (919-76-6) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24-36 | | HS Code | 29309090 |
| | AMIDITHION Usage And Synthesis |
| Description | Amidithion is a largely obsolete organophosphate insecticide that was mainly used on turf. It is highly soluble in water and has a low volatility, but little is known about its fate or persistence in ecosystems. Based on its chemical structure it is expected to be moderately to highly toxic to humans and biodiversity. | | Uses | Amidithion is a pesticide | | Definition | ChEBI: Amidithion is an organic thiophosphate. | | Production Methods | Amidithion is commercially produced through the esterification of phosphorodithioic acid with 2-mercapto-N-(2-methoxyethyl)acetamide. This synthesis involves the reaction of O,O-dimethyl phosphorodithioate with a thiol-containing amide under controlled conditions, typically in the presence of a base and an inert solvent to facilitate the formation of the S-ester bond. | | Mechanism of action | Acetylcholine esterase inhibitor | | Pesticide Type | Insecticide; Acaricide |
| | AMIDITHION Preparation Products And Raw materials |
|