| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:AMIDITHION
CAS:919-76-6
|
| Company Name: |
Alta Scientific Co., Ltd. Gold
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Amidithion
CAS:919-76-6
Purity:99% Package:10mg;100mg;1g
|
|
| | AMIDITHION Basic information |
| Product Name: | AMIDITHION | | Synonyms: | O,O-Dimethyl ester, S-ether-2-mercapto-N-(2-methoxyethyl)acetamide thiophosphonic acid;amidithion (ISO) 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate;2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate;amidiphos (f);amidithion (bsi,iso,esa,ansi);2-dimethoxyphosphinothioylsulfanyl-N-(2-methoxyethyl)acetamide;acetamide,2-mercapto-n-(2-methoxyethyl)-,s-esterwitho,o-dimethylphosphor;amidiphos | | CAS: | 919-76-6 | | MF: | C7H16NO4PS2 | | MW: | 273.31 | | EINECS: | | | Product Categories: | | | Mol File: | 919-76-6.mol |  |
| | AMIDITHION Chemical Properties |
| density | 1.270±0.06 g/cm3(Predicted) | | pka | 13?+-.0.46(Predicted) | | InChI | InChI=1S/C7H16NO4PS2/c1-10-5-4-8-7(9)6-15-13(14,11-2)12-3/h4-6H2,1-3H3,(H,8,9) | | InChIKey | GDTZUQIYUMGJRT-UHFFFAOYSA-N | | SMILES | P(=S)(SCC(NCCOC)=O)(OC)OC | | EPA Substance Registry System | Amidithion (919-76-6) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24-36 | | HS Code | 29309090 |
| | AMIDITHION Usage And Synthesis |
| Uses | Amidithion is a pesticide | | Definition | ChEBI: Amidithion is an organic thiophosphate. |
| | AMIDITHION Preparation Products And Raw materials |
|