|
|
| | 4,4'-Methylenebis(N,N-diglycidylaniline) Basic information |
| Product Name: | 4,4'-Methylenebis(N,N-diglycidylaniline) | | Synonyms: | 4,4’-Methylenebis(diglycidylaniline);n,n’-(methylenedi-4,1-phenylene)bis[n-(oxiranylmethyl)-oxiranemethanamin;N,N’-(methylenedi-4,1-phenylene)bis[N-(oxiranylmethyl)-Oxiranemethanamine;tetraglycidyl-4,4’-methylenedianiline;4,4'-methylenebis[N,N-bis(2,3-epoxypropyl)aniline];Oxiranemethanamine, N,N-(methylenedi-4,1-phenylene)bisN-(oxiranylmethyl)-;4,4′-Methylenbis(N,N-bis(2,3-epoxypropyl)anilin);1,1'-Methylenebis[4-[bis(oxiranylmethyl)amino]benzene] | | CAS: | 28768-32-3 | | MF: | C25H30N2O4 | | MW: | 422.52 | | EINECS: | 249-204-3 | | Product Categories: | Epoxide Monomers;Monomers;Polymer Science;Organics | | Mol File: | 28768-32-3.mol |  |
| | 4,4'-Methylenebis(N,N-diglycidylaniline) Chemical Properties |
| Boiling point | 619.3±35.0 °C(Predicted) | | density | 1.15 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 24.85℃ | | refractive index | n20/D 1.601(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | pka | 4.58±0.50(Predicted) | | form | clear liquid | | color | Light yellow to Brown | | Water Solubility | 9.2mg/L at 20℃ | | InChI | InChI=1S/C25H30N2O4/c1-5-20(26(10-22-14-28-22)11-23-15-29-23)6-2-18(1)9-19-3-7-21(8-4-19)27(12-24-16-30-24)13-25-17-31-25/h1-8,22-25H,9-17H2 | | InChIKey | FAUAZXVRLVIARB-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(N(CC2CO2)CC2CO2)C=C1)C1=CC=C(N(CC2CO2)CC2CO2)C=C1 | | LogP | 2.12 at 22℃ | | EPA Substance Registry System | Oxiranemethanamine, N,N'-(methylenedi-4,1-phenylene)bis[N-(oxiranylmethyl)- (28768-32-3) |
| Hazard Codes | Xi,N | | Risk Statements | 43-51/53 | | Safety Statements | 36/37-61 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 2 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29225090 |
| | 4,4'-Methylenebis(N,N-diglycidylaniline) Usage And Synthesis |
| Chemical Properties | Yellow sticky liquid | | Uses | 4,4μ-Methylenebis(N,N-diglycidylaniline) can be used:- As a starting material to synthesize UV-curable tetra-functional epoxy acrylate (EA4), which is used as a crosslinker for UV-curable resins.
- In the synthesis of bismaleimide/diallyl bisphenol A (BMI/DBA)–epoxy interpenetrating network resins, which have potential applications in the aerospace and automotive industries because of their high thermal stability and low activation energy.
- As a crosslinking agent in the production of biocompatible materials, such as hydrogels and other tissue engineering scaffolds. Its ability to form strong and stable crosslinks makes it valuable in the creation of medical devices, implants, and drug delivery systems. Additionally, it is utilized in the synthesis of biocompatible polymers and materials with tailored properties for biomedical applications.
4,4μ-Methylenebis(N,N-diglycidylaniline) can be also used as a precursor to synthesize:- Poly(hexamethylene biguanide) based polymer networks which are applicable as catalysts for the transesterification of vegetable oils.
- Tetra-functional epoxy-acrylate UV curable resins.
It can also be used as a crosslinker to functionalize carbon nanotubes to improve their mechanical strength. |
| | 4,4'-Methylenebis(N,N-diglycidylaniline) Preparation Products And Raw materials |
|