|
|
| | (R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE Basic information |
| Product Name: | (R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE | | Synonyms: | (R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE;(R)-4-(CHLOROMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(R)-3-CHLORO-1,2-PROPANEDIOL ACETONIDE;1,3-DIOXOLANE, 4-(CHLOROMETHYL)-2,2-DIMETHYL-, (4R)-;R-Chloropropanediol acetonide;(R)-2,2-Dimethyl-4-Chloromethyl-1,3-Dioxolane;(R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE , EE 98%;(R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE, 98%, EE 9 | | CAS: | 57044-24-3 | | MF: | C6H11ClO2 | | MW: | 150.6 | | EINECS: | 629-411-9 | | Product Categories: | Heterocyclic Compounds;Chiral Building Blocks;Organic Building Blocks;Protected Alcohols | | Mol File: | 57044-24-3.mol |  |
| | (R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE Chemical Properties |
| alpha | 42.1 º (NEAT) | | Boiling point | 63 °C37 mm Hg(lit.) | | density | 1.103 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.434(lit.) | | Fp | 123 °F | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]24/D +42.1°, neat | | BRN | 4654188 | | InChI | InChI=1S/C6H11ClO2/c1-6(2)8-4-5(3-7)9-6/h5H,3-4H2,1-2H3/t5-/m0/s1 | | InChIKey | BNPOTXLWPZOESZ-YFKPBYRVSA-N | | SMILES | O1C[C@H](CCl)OC1(C)C | | CAS DataBase Reference | 57044-24-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-41 | | Safety Statements | 16-26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29329990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3 |
| | (R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE Usage And Synthesis |
| Chemical Properties | Clear colorless to yellow liquid | | Uses | (R)-4-Chloromethyl-2,2-dimethyl-1,3-dioxolane is often used in biosynthetic preparations. | | Uses | Utilized in the preparation of both enantiomers of the orally active antifungal azolic agent ketoconazole. |
| | (R)-(+)-4-CHLOROMETHYL-2,2-DIMETHYL-1,3-DIOXOLANE Preparation Products And Raw materials |
|