| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Chromium(III) acetate hydroxide manufacturers
|
| | Chromium(III) acetate hydroxide Basic information |
| | Chromium(III) acetate hydroxide Chemical Properties |
| density | 0.909[at 20℃] | | solubility | very soluble in H2O | | form | Crystals | | color | Blue | | Water Solubility | Soluble in water. Insoluble in acetone. Soluble in hot water | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/7C2H4O2.3Cr.2H2O/c7*1-2(3)4;;;;;/h7*1H3,(H,3,4);;;;2*1H2/q;;;;;;;3*+3;;/p-9 | | InChIKey | KDYFYAUIXHZPBG-UHFFFAOYSA-E | | SMILES | CC(=O)O[Cr](O)O.CC(=O)O[Cr](OC(C)=O)OC(C)=O.CC(=O)O[Cr](OC(C)=O)OC(C)=O | | LogP | 0.2 at 22℃ | | CAS DataBase Reference | 39430-51-8(CAS DataBase Reference) | | EPA Substance Registry System | Acetic acid, chromium salt, basic (39430-51-8) |
| | Chromium(III) acetate hydroxide Usage And Synthesis |
| Chemical Properties | violet powder(s); commercial material used as a mordant in dyeing, in tanning, and as an oxidation catalyst; formula also written as Cr3(CH3COO)7(OH)2 [ALD94] [MER06] | | Uses | Occasionally to dehalogenate organic compounds. used as an oxygen scrubber, polymer industry. | | Uses | Chromium(III) acetate hydroxide can be used for a variety of industrial applications which include dyeing, photographic emulsion, and tanning. It can also be used as a catalyst in the synthesis of monoacylglycerols by the glycidol-fatty acid reaction. | | Flammability and Explosibility | Non flammable | | reaction suitability | core: chromium |
| | Chromium(III) acetate hydroxide Preparation Products And Raw materials |
|