| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:93951-91-8
Purity:100 ng/ul于乙腈 Package:1.1ml
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:3,3'-Dichlorobenzidine-d6
CAS:93951-91-8
Remarks:CS-C-00435
|
| Company Name: |
Artis Biotech Co. Ltd.
|
| Tel: |
19138486554; 18108108965 |
| Email: |
sales@artisbio.com |
| Products Intro: |
Product Name:3,3'-Dichlorobenzidine-d6
CAS:93951-91-8
Purity:98%HPLC Package:1mg;5mg;10mg;50mg
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:3,3'-Dichlorobenzidine-d6 (rings-d6)
CAS:93951-91-8
Purity:98% Package:5g;25g;100g Remarks:Environmental Standards
|
3,3'-DICHLOROBENZIDINE-D6 (RINGS-D6) manufacturers
|
| | 3,3'-DICHLOROBENZIDINE-D6 (RINGS-D6) Basic information |
| Product Name: | 3,3'-DICHLOROBENZIDINE-D6 (RINGS-D6) | | Synonyms: | 3,3'-DICHLOROBENZIDINE (RING-D6);3,3′-Dichlorobenzidine D6 (ring D6);3,3'-Dichlorobenzidine-d6;3,3'-Dichloro-[1,1'-biphenyl]-2,2',5,5',6,6'-d6-4,4'-diamine;4-(4-amino-3-chloro-2,5,6-trideuterio-phenyl)-2-chloro-3,5,6-trideuterio-aniline;3,3 '- Dichlorobenzene-d6;3,3'-Dichloro-[1,1'-biphenyl]-4,4'-diamine-d6;3,3'-Dichlorobenzidine-d6 (rings-d6) | | CAS: | 93951-91-8 | | MF: | C12H4Cl2D6N2 | | MW: | 259.16 | | EINECS: | | | Product Categories: | | | Mol File: | 93951-91-8.mol |  |
| | 3,3'-DICHLOROBENZIDINE-D6 (RINGS-D6) Chemical Properties |
| solubility | Acetone (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | 1S/C12H10Cl2N2/c13-9-5-7(1-3-11(9)15)8-2-4-12(16)10(14)6-8/h1-6H,15-16H2/i1D,2D,3D,4D,5D,6D | | InChIKey | HUWXDEQWWKGHRV-MZWXYZOWSA-N | | SMILES | NC1=C(Cl)C([2H])=C(C2=C([2H])C([2H])=C(N)C(Cl)=C2[2H])C([2H])=C1[2H] | | EPA Substance Registry System | 3,3'-Dichlorobenzidine-d6 (93951-91-8) |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B
Skin Sens. 1 |
| | 3,3'-DICHLOROBENZIDINE-D6 (RINGS-D6) Usage And Synthesis |
| Uses | 3,3'-Dichlorobenzidine-d6 is an isotope analog of 3,3'-Dichlorobenzidine. 3,3'-Dichlorobenzidine, is structurally similar to Benzidine (B121000), and thus is considered a carcinogen. It can be used in the production of azo dyes. Dyes and metabolites, Environmental Testing |
| | 3,3'-DICHLOROBENZIDINE-D6 (RINGS-D6) Preparation Products And Raw materials |
|