| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1R,4R)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene Basic information |
| Product Name: | (1R,4R)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene | | Synonyms: | (1S,3R)-CIS-4-CARENE;(1S,3R,6R)-3,7,7-Trimethylbicyclo[4.1.0]hepta-4-ene;[1S,3R,6R,(-)]-3,7,7-Trimethylbicyclo[4.1.0]hepta-4-ene;[1S,3R,6R,(-)]-4-Carene;(1S,3R)-cis-4-Carene >=95.0% (sum of enantiomers, GC);Bicyclo[4.1.0]hept-2-ene, 4,7,7-trimethyl-, (1R,4R,6S)-;(1S,3R)-cis-4-Carene;(1R,4R,6S)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene | | CAS: | 5208-49-1 | | MF: | C10H16 | | MW: | 136.23 | | EINECS: | | | Product Categories: | | | Mol File: | 5208-49-1.mol | ![(1R,4R)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene Structure](CAS/GIF/5208-49-1.gif) |
| | (1R,4R)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene Chemical Properties |
| Melting point | 25°C (estimate) | | Boiling point | 170.55°C (estimate) | | density | 0.849 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.469 | | Fp | 38 °C | | form | liquid | | Optical Rotation | [α]20/D 145±5°, neat | | BRN | 3044038 | | InChI | 1S/C10H16/c1-7-4-5-8-9(6-7)10(8,2)3/h4-5,7-9H,6H2,1-3H3/t7-,8+,9-/m0/s1 | | InChIKey | LGNSZMLHOYDATP-YIZRAAEISA-N | | SMILES | [H][C@]12C[C@@H](C)C=C[C@@]1([H])C2(C)C | | LogP | 4.274 (est) |
| Risk Statements | 10 | | Safety Statements | 23-24/25 | | RIDADR | UN 2319 3/PG 3 | | WGK Germany | 3 | | F | 10 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | (1R,4R)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene Usage And Synthesis |
| | (1R,4R)-4,7,7-Trimethylbicyclo[4.1.0]hept-2-ene Preparation Products And Raw materials |
|