| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
4-NITROINDAN manufacturers
- 4-NITROINDAN
-
- $1.00
-
2024-07-29
- CAS:34701-14-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 4-Nitroindan
-
-
2022-09-12
- CAS:34701-14-9
- Min. Order: 1G
- Purity: 98%minNMR
- Supply Ability: 50kg/month
|
| | 4-NITROINDAN Basic information |
| | 4-NITROINDAN Chemical Properties |
| Melting point | 41-43 °C (lit.) | | Boiling point | 105-107 °C/6 mmHg (lit.) | | density | 1.2021 (rough estimate) | | refractive index | 1.5460 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | InChI | 1S/C9H9NO2/c11-10(12)9-6-2-4-7-3-1-5-8(7)9/h2,4,6H,1,3,5H2 | | InChIKey | ZQABKMBXKCJTPM-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc2CCCc12 |
| WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids |
| | 4-NITROINDAN Usage And Synthesis |
| | 4-NITROINDAN Preparation Products And Raw materials |
|