| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester Basic information |
| Product Name: | Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester | | Synonyms: | (2-Cyanophenyl)carbamic acid 1,1-dimethylethyl ester;2-(tert-Butoxycarbonylamino)benzonitrile;N-Boc-2-aminobenzonitrile;Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester (9CI);Carbamic acid, N-(2-cyanophenyl)-, 1,1-dimethylethyl ester;N-Boc-2-aminobenzonitrile 97%;N-Boc-2-aminobenzonitrile;Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester | | CAS: | 163229-43-4 | | MF: | C12H14N2O2 | | MW: | 218.25 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 163229-43-4.mol |  |
| | Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester Chemical Properties |
| Melting point | 74-77°C | | Boiling point | 165 °C(Press: 2 Torr) | | density | 1.12±0.1 g/cm3(Predicted) | | pka | 12.77±0.70(Predicted) | | form | solid | | InChI | 1S/C12H14N2O2/c1-12(2,3)16-11(15)14-10-7-5-4-6-9(10)8-13/h4-7H,1-3H3,(H,14,15) | | InChIKey | CEYTZDSWLJPPRT-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Nc1ccccc1C#N |
| Hazard Codes | Xi,N | | Risk Statements | 36-38-51/53 | | Safety Statements | 26-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2 |
| | Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester Usage And Synthesis |
| | Carbamic acid, (2-cyanophenyl)-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|